Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5 g | In stock | 99%+ |
| Transport Condition | Room temperature |
|---|---|
| Storage Temp. | Keep in dark place, Sealed in dry, Room Temperature |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | White to light yellow powder |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H332-H335 |
| Flash Point | |
| Safety Statements | P261-P280-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | WDVGNXKCFBOKDF-UHFFFAOYSA-N |
| Canonical Smiles | CC(C)C1C=C(C(C)C)C(C2C(=C(C=CC=2OC)OC)P(C2CCCCC2)C2CCCCC2)=C(C=1)C(C)C |
| Inchi | InChI=1S/C35H53O2P/c1-23(2)26-21-29(24(3)4)33(30(22-26)25(5)6)34-31(36-7)19-20-32(37-8)35(34)38(27-15-11-9-12-16-27)28-17-13-10-14-18-28/h19-25,27-28H,9-18H2,1-8H3 |
| Density | |
| MDL No. | MFCD11973797 |
| Water Solubility | |
| Exact Mass | 536.37832 |
| Chirality | |
| GHS | |
| Cas No. | 1070663-78-3 |
| Chemical Name | BrettPhos |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
