Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5g | In stock | 98% | |
| 10g | In stock | 98% |
| Transport Condition | Room temperature |
|---|---|
| Storage Temp. | Inert atmosphere, Room Temperature |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | White To Off-White Powder Or Solid Or Chunks |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | VNFWTIYUKDMAOP-UHFFFAOYSA-N |
| Canonical Smiles | COC1=CC=CC(OC)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 |
| Inchi | InChI=1S/C26H35O2P/c1-27-23-17-11-18-24(28-2)26(23)22-16-9-10-19-25(22)29(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h9-11,16-21H,3-8,12-15H2,1-2H3 |
| Density | |
| MDL No. | MFCD05861611 |
| Water Solubility | |
| Exact Mass | 410.23747 |
| Chirality | |
| GHS | warning |
| Cas No. | 657408-07-6 |
| Chemical Name | SPhos |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
