Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5 g | In stock | 98%+ |
| Transport Condition | Room temperature |
|---|---|
| Storage Temp. | Store in a cool,dry area. |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | White To Beige Powder Or Crystals |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | CXNIUSPIQKWYAI-UHFFFAOYSA-N |
| Canonical Smiles | CC1(C)C2C=CC=C(C=2OC2C(=CC=CC1=2)P(C1C=CC=CC=1)C1C=CC=CC=1)P(C1C=CC=CC=1)C1C=CC=CC=1 |
| Inchi | InChI=1S/C39H32OP2/c1-39(2)33-25-15-27-35(41(29-17-7-3-8-18-29)30-19-9-4-10-20-30)37(33)40-38-34(39)26-16-28-36(38)42(31-21-11-5-12-22-31)32-23-13-6-14-24-32/h3-28H,1-2H3 |
| Density | |
| MDL No. | |
| Water Solubility | |
| Exact Mass | 578.19284 |
| Chirality | |
| GHS | Warning |
| Cas No. | 161265-03-8 |
| Chemical Name | Xantphos |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
