Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
|
Sorry, there is no price information yet |
|||
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Keep in dark place, Inert atmosphere, 2-8°C |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | Yellow to dark yellow solid |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319 |
| Flash Point | |
| Safety Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | VHQUELUASRQSPI-UHFFFAOYSA-N |
| Canonical Smiles | [O-][N+](=O)C1=CC=CC=C1NC1C=CN=CC=1 |
| Inchi | InChI=1S/C11H9N3O2/c15-14(16)11-4-2-1-3-10(11)13-9-5-7-12-8-6-9/h1-8H,(H,12,13) |
| Density | |
| MDL No. | MFCD02178025 |
| Water Solubility | |
| Exact Mass | 215.06948 |
| Chirality | |
| GHS | |
| Cas No. | 25551-59-1 |
| Chemical Name | N-(2-NITROPHENYL)PYRIDIN-4-AMINE |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
