Pack Size | Availability | Purity | Price |
---|---|---|---|
1g | In stock | 98%+ |
Transport Condition | 2-8°C |
---|---|
Storage Temp. | 2-8°C, protect from light |
GHS Pictogram | ![]() |
Hazard category | |
Biological Activity | |
Character | The boiling point is 153 °C, the melting point is 35 °C - 36 °C, and the flash point is 73 °C. |
Chemical Stability | |
Hazardous Decomposition Products | |
Useage | |
Risk Statements | H315-H319-H335 |
Flash Point | |
Safety Statements | P261-P305+P351+P338 |
Physicochemical Propertie | |
Vapor Pressure |
Signal Word | Warning |
---|---|
InchiKey | NOXLGCOSAFGMDV-UHFFFAOYSA-N |
Canonical Smiles | NC1C(F)=C(F)C(F)=C(F)C=1F |
Inchi | InChI=1S/C6H2F5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
Density | 1.744 |
MDL No. | MFCD00007643 |
Water Solubility | Sparingly soluble |
Exact Mass | 183.01074 |
Chirality | |
GHS | |
Cas No. | 771-60-8 |
Chemical Name | 2,3,4,5,6-Pentafluoroaniline |
UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available