| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | 2-8°C, protect from light |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | The boiling point is 153 °C, the melting point is 35 °C - 36 °C, and the flash point is 73 °C. |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | NOXLGCOSAFGMDV-UHFFFAOYSA-N |
| Canonical Smiles | NC1C(F)=C(F)C(F)=C(F)C=1F |
| Inchi | InChI=1S/C6H2F5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
| MDL No. | MFCD00007643 |
| GHS | |
| Cas No. | 771-60-8 |
| Chemical Name | 2,3,4,5,6-Pentafluoroaniline |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory