Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 250 mg | In stock | 98% |
| Transport Condition | |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | HHMRNTYSPKCFLP-UHFFFAOYSA-N |
| Canonical Smiles | Cc1c[n]c(CN)c[n]1.CC(O)=O |
| Inchi | InChI=1S/C6H9N3.C2H4O2/c1-5-3-9-6(2-7)4-8-5;1-2(3)4/h3-4H,2,7H2,1H3;1H3,(H,3,4) |
| Density | |
| MDL No. | |
| Water Solubility | |
| Exact Mass | 183.10078 |
| Chirality | |
| GHS | |
| Cas No. | 3026677-38-0 |
| Chemical Name | (5-Methylpyrazin-2-yl)methanamine acetate |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
