Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 100 mg | In stock | 98% |
| Transport Condition | |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | XPLMUHLYLOBJST-UHFFFAOYSA-N |
| Canonical Smiles | Cl.NC1CC(=O)C2=CC=CC=C21 |
| Inchi | InChI=1S/C9H9NO.ClH/c10-8-5-9(11)7-4-2-1-3-6(7)8;/h1-4,8H,5,10H2;1H |
| Density | |
| MDL No. | MFCD11845790 |
| Water Solubility | |
| Exact Mass | 183.04509 |
| Chirality | |
| GHS | |
| Cas No. | 152605-34-0 |
| Chemical Name | 3-Amino-2,3-dihydro-1H-inden-1-one hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
