Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5g | 2 -3 weeks | 98%+ | |
| 25g | 2 -3 weeks | 98%+ | |
| 100g | 2 -3 weeks | 98%+ | |
| 500g | 2 -3 weeks | 98%+ | |
| 2.5kg | 2 -3 weeks | 98%+ |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | 2-8°C, protect from light |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | Light yellow solid |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | NFCPRRWCTNLGSN-UHFFFAOYSA-N |
| Canonical Smiles | NC1=CC=CC=C1NC1C=CC=CC=1 |
| Inchi | InChI=1S/C12H12N2/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H,13H2 |
| Density | 1.167 g/cm3 |
| MDL No. | MFCD00007685 |
| Water Solubility | Soluble in acetone and chloroformbenzene |
| Exact Mass | 184.10005 |
| Chirality | |
| GHS | |
| Cas No. | 534-85-0 |
| Chemical Name | N1-Phenylbenzene-1,2-diamine |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
