Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 100 mg | In stock | 96% |
| Transport Condition | room temperature |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | YYOVGEAEEZWWBC-UHFFFAOYSA-N |
| Canonical Smiles | Cl.NCC1=NC2=CC=CC=C2O1 |
| Inchi | InChI=1S/C8H8N2O.ClH/c9-5-8-10-6-3-1-2-4-7(6)11-8;/h1-4H,5,9H2;1H |
| Density | |
| MDL No. | MFCD09763577 |
| Water Solubility | |
| Exact Mass | 184.04034 |
| Chirality | |
| GHS | |
| Cas No. | 1072806-65-5 |
| Chemical Name | Benzo[d]oxazol-2-ylmethanamine hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
