Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
|
Sorry, there is no price information yet |
|||
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | 2-8°C, protect from light |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | It is a white solid powder, soluble in solvents such as dichloroethane, and hardly soluble in water |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | OEQQFQXMCPMEIH-UHFFFAOYSA-N |
| Canonical Smiles | NC1=NC2C(Cl)=CC=CC=2S1 |
| Inchi | InChI=1S/C7H5ClN2S/c8-4-2-1-3-5-6(4)10-7(9)11-5/h1-3H,(H2,9,10) |
| Density | 1.532 g/cm3 |
| MDL No. | MFCD00005791 |
| Water Solubility | sparingly soluble |
| Exact Mass | 183.98620 |
| Chirality | |
| GHS | |
| Cas No. | 19952-47-7 |
| Chemical Name | 4-Chlorobenzo[d]thiazol-2-amine |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
