5-Methyl-2-(prop-1-en-2-yl)cyclohexan-1-ol
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 1g |
2 -3 weeks |
95% stabilized with MEHQ |
|
|
|
| 5g |
2 -3 weeks |
95% stabilized with MEHQ |
|
|
|
| 25g |
2 -3 weeks |
95% stabilized with MEHQ |
|
|
|
| Transport Condition |
2-8℃ |
| Storage Temp. |
2-8℃ |
| GHS Pictogram |
 |
| Hazard category |
- |
| Character |
|
| Useage |
|
| Risk Statements |
H319;H302;H315; |
| Safety Statements |
P210-P233-P240-P243-P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362-P374-P403+P235-P404-P501 |
| Physicochemical Propertie |
|
| Signal Word |
Warning |
| InchiKey |
ZYTMANIQRDEHIO-UHFFFAOYSA-N |
| Canonical Smiles |
CC1CCC(C(O)C1)C(C)=C |
| Inchi |
InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3 |
| MDL No. |
MFCD00001479 |
| GHS |
|
| Cas No. |
7786-67-6 |
| Chemical Name |
5-Methyl-2-(prop-1-en-2-yl)cyclohexan-1-ol |
| UN No. |
- |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available