Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 1g | 2 -3 weeks | 95% (stabilized with Na2S2O3) | |||
| 5g | 2 -3 weeks | 95% (stabilized with Na2S2O3) | |||
| 25g | 2 -3 weeks | 95% (stabilized with Na2S2O3) |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Keep in dark place,Inert atmosphere,2-8°C |
| GHS Pictogram |  |
| Hazard category | 8 |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H314 |
| Flash Point | |
| Safety Statements | P280-P305+P351+P338-P310 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | XSLYISNQTJHKMP-UHFFFAOYSA-N |
| Canonical Smiles | O=S(=O)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)I |
| Inchi | InChI=1S/C4F9IO3S/c5-1(6,14)2(7,8)17-3(9,10)4(11,12)18(13,15)16 |
| Density | |
| MDL No. | MFCD00798139 |
| Water Solubility | |
| Exact Mass | 425.84691 |
| Chirality | |
| GHS | |
| Cas No. | 66137-74-4 |
| Chemical Name | Tetrafluoro-2-(Tetrafluoro-2-Iodoethoxy)Ethanesulfonyl Fluoride |
| UN No. | 3265 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
