Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 25g | 2 -3 weeks | 97% (stabilized with MEHQ) | |
| 100g | 2 -3 weeks | 97% (stabilized with MEHQ) | |
| 500g | 2 -3 weeks | 97% (stabilized with MEHQ) |
| Transport Condition | Store in a cool,dry area. |
|---|---|
| Storage Temp. | Store in a cool,dry area. |
| GHS Pictogram |   |
| Hazard category | 6.1 |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H318;H311;H301; |
| Flash Point | |
| Safety Statements | P210-P264-P270-P280-P301+P310+P330-P302+P352+P312-P305+P351+P338+P310-P332+P313-P370+P378-P403+P235-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | YLGYACDQVQQZSW-UHFFFAOYSA-N |
| Canonical Smiles | CN(C)C(=O)C=C |
| Inchi | InChI=1S/C5H9NO/c1-4-5(7)6(2)3/h4H,1H2,2-3H3 |
| Density | |
| MDL No. | MFCD00008626 |
| Water Solubility | |
| Exact Mass | 99.06841 |
| Chirality | |
| GHS | |
| Cas No. | 2680-03-7 |
| Chemical Name | N,N-Dimethylacrylamide |
| UN No. | 2810 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
