| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 5g | 2 -3 weeks | 0.98 | |||
| 10g | 2 -3 weeks | 97% | |||
| 25g | 2 -3 weeks | 0.98 | |||
| 100g | 2 -3 weeks | 0.98 |
| Transport Condition | Room Temperature |
|---|---|
| Storage Temp. | Inert atmosphere,Room Temperature |
| GHS Pictogram | ![]() |
| Hazard category | - |
| Biological Activity | |
| Character | white (Solid) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | RQKGHIGGSFNVGW-UHFFFAOYSA-N |
| Canonical Smiles | CCOC(=O)C1=CC(=CC=C1)B1OC(C)(C)C(C)(C)O1 |
| Inchi | InChI=1S/C15H21BO4/c1-6-18-13(17)11-8-7-9-12(10-11)16-19-14(2,3)15(4,5)20-16/h7-10H,6H2,1-5H3 |
| Density | |
| MDL No. | MFCD03093896 |
| Water Solubility | |
| Exact Mass | 276.15329 |
| Chirality | |
| GHS | |
| Cas No. | 269410-00-6 |
| Chemical Name | 3-Ethoxycarbonylphenylboronic Acid Pinacol Ester |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory