Theaspirane,mixture of cis and trans
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 250mg |
2 -3 weeks |
96% |
|
|
|
| 1g |
2 -3 weeks |
90% +(GC)(isomers mixture) |
|
|
|
| 1g |
2 -3 weeks |
96% |
|
|
|
| 5g |
2 -3 weeks |
96% |
|
|
|
| 5g |
2 -3 weeks |
90% +(GC)(isomers mixture) |
|
|
|
| 10g |
2 -3 weeks |
96% |
|
|
|
| 25g |
2 -3 weeks |
90% +(GC)(isomers mixture) |
|
|
|
| 100g |
2 -3 weeks |
90% +(GC)(isomers mixture) |
|
|
|
| Transport Condition |
Room Temperature |
| Storage Temp. |
Sealed in dry,Room Temperature |
| GHS Pictogram |
 |
| Hazard category |
- |
| Character |
|
| Useage |
|
| Risk Statements |
H227-H315-H319-H335 |
| Safety Statements |
P305+P351+P338 |
| Physicochemical Propertie |
|
| Signal Word |
Warning |
| InchiKey |
GYUZHTWCNKINPY-UHFFFAOYSA-N |
| Canonical Smiles |
CC1(C)CCC=C(C)C21CCC(C)O2 |
| Inchi |
InChI=1S/C13H22O/c1-10-6-5-8-12(3,4)13(10)9-7-11(2)14-13/h6,11H,5,7-9H2,1-4H3 |
| MDL No. |
MFCD00085214 |
| GHS |
|
| Cas No. |
36431-72-8 |
| Chemical Name |
Theaspirane,mixture of cis and trans |
| UN No. |
- |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available