Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 10g | 2 -3 weeks | 97%,mixture of isomers | |
| 25g | 2 -3 weeks | 97%,mixture of isomers | |
| 100g | 2 -3 weeks | 97%,mixture of isomers | |
| 500g | 2 -3 weeks | 97%,mixture of isomers |
| Transport Condition | Room Temperature |
|---|---|
| Storage Temp. | Sealed in dry,Room Temperature |
| GHS Pictogram |    |
| Hazard category | 9 |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H318-H410 |
| Flash Point | |
| Safety Statements | P273-P280-P301+P312+P330-P305+P351+P338+P310 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | PMGCQNGBLMMXEW-UHFFFAOYSA-N |
| Canonical Smiles | CC(C)CCOC(=O)C1=CC=CC=C1O |
| Inchi | InChI=1S/C12H16O3/c1-9(2)7-8-15-12(14)10-5-3-4-6-11(10)13/h3-6,9,13H,7-8H2,1-2H3 |
| Density | |
| MDL No. | MFCD00020037 |
| Water Solubility | |
| Exact Mass | 208.10995 |
| Chirality | |
| GHS | |
| Cas No. | 87-20-7 |
| Chemical Name | Isoamyl o-Hydroxybenzoate |
| UN No. | 3082 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
