Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 10g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 25g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 100g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 500g | 2 -3 weeks | 97% (stabilized with BHT) |
| Transport Condition | 2-8℃ |
|---|---|
| Storage Temp. | 2-8℃ |
| GHS Pictogram |     |
| Hazard category | 3(6.1) |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H360;H372;H225;H301;H411; |
| Flash Point | |
| Safety Statements | P273-P260-P210-P370+P378-P391-P301+P310+P330 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | ZTZJVAOTIOAZGZ-UHFFFAOYSA-N |
| Canonical Smiles | COC(=O)C(=C)F |
| Inchi | InChI=1S/C4H5FO2/c1-3(5)4(6)7-2/h1H2,2H3 |
| Density | |
| MDL No. | MFCD04039286 |
| Water Solubility | |
| Exact Mass | 104.02736 |
| Chirality | |
| GHS | |
| Cas No. | 2343-89-7 |
| Chemical Name | Methyl 2-Fluoroacrylate |
| UN No. | 1992 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
