Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 25g | 2 -3 weeks | 98% (stabilized with MEHQ) | |
| 100g | 2 -3 weeks | 98% (stabilized with MEHQ) | |
| 500g | 2 -3 weeks | 98% (stabilized with MEHQ) | |
| 1kg | 2 -3 weeks | 98% (stabilized with MEHQ) |
| Transport Condition | 2-8℃,Under inert gas. |
|---|---|
| Storage Temp. | 2-8℃,Under inert gas. |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H319;H302;H315; |
| Flash Point | |
| Safety Statements | P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | OVHHHVAVHBHXAK-UHFFFAOYSA-N |
| Canonical Smiles | CCN(CC)C(=O)C=C |
| Inchi | InChI=1S/C7H13NO/c1-4-7(9)8(5-2)6-3/h4H,1,5-6H2,2-3H3 |
| Density | |
| MDL No. | MFCD00078408 |
| Water Solubility | |
| Exact Mass | 127.09971 |
| Chirality | |
| GHS | |
| Cas No. | 2675-94-7 |
| Chemical Name | N,N-Diethyl-2-Acrylamide |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
