Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 100mg | 2 -3 weeks | 98% (stabilized with MEHQ) | |
| 250mg | 2 -3 weeks | 98% (stabilized with MEHQ) | |
| 1g | 2 -3 weeks | 98% (stabilized with MEHQ) | |
| 5g | 2 -3 weeks | 98% (stabilized with MEHQ) | |
| 25g | 2 -3 weeks | 98% (stabilized with MEHQ) |
| Transport Condition | Store in a cool,dry area. |
|---|---|
| Storage Temp. | Store in a cool,dry area. |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302; |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | SWPMNMYLORDLJE-UHFFFAOYSA-N |
| Canonical Smiles | CCNC(=O)C=C |
| Inchi | InChI=1S/C5H9NO/c1-3-5(7)6-4-2/h3H,1,4H2,2H3,(H,6,7) |
| Density | |
| MDL No. | MFCD00048514 |
| Water Solubility | |
| Exact Mass | 99.06841 |
| Chirality | |
| GHS | |
| Cas No. | 5883-17-0 |
| Chemical Name | N-Ethyl-2-Propenamide |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
