Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 5g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 25g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 100g | 2 -3 weeks | 97% (stabilized with BHT) | |
| 500g | 2 -3 weeks | 97% (stabilized with BHT) |
| Transport Condition | Store in a cool,dry area. |
|---|---|
| Storage Temp. | Store in a cool,dry area. |
| GHS Pictogram |   |
| Hazard category | 3 |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H317;H302;H335; |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | QIWKUEJZZCOPFV-UHFFFAOYSA-N |
| Canonical Smiles | CC(=C)C(=O)OC1C=CC=CC=1 |
| Inchi | InChI=1S/C10H10O2/c1-8(2)10(11)12-9-6-4-3-5-7-9/h3-7H,1H2,2H3 |
| Density | |
| MDL No. | MFCD00048117 |
| Water Solubility | |
| Exact Mass | 162.06808 |
| Chirality | |
| GHS | |
| Cas No. | 2177-70-0 |
| Chemical Name | Phenyl Methacrylate |
| UN No. | 3272 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
