2-Formylphenylboronic Acid Pinacol Ester
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
Melting Point :
Boiling Point :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 25g |
2 -3 weeks |
95% |
|
|
|
| 100g |
2 -3 weeks |
95% |
|
|
|
| Transport Condition |
2-8℃,Under inert gas. |
| Storage Temp. |
2-8℃,Under inert gas. |
| GHS Pictogram |
 |
| Hazard category |
- |
| Biological Activity |
|
| Character |
colorless (Liquid) |
| Chemical Stability |
|
| Hazardous Decomposition Products |
|
| Useage |
|
| Risk Statements |
H319;H335;H315; |
| Flash Point |
|
| Safety Statements |
P261-P305+P351+P338 |
| Physicochemical Propertie |
|
| Vapor Pressure |
|
| Signal Word |
Warning |
| InchiKey |
SLJMPQLPRHIAOM-UHFFFAOYSA-N |
| Canonical Smiles |
CC1(C)OB(OC1(C)C)C1=CC=CC=C1C=O |
| Inchi |
InChI=1S/C13H17BO3/c1-12(2)13(3,4)17-14(16-12)11-8-6-5-7-10(11)9-15/h5-9H,1-4H3 |
| Density |
|
| MDL No. |
MFCD07363841 |
| Water Solubility |
|
| Exact Mass |
232.12708 |
| Chirality |
|
| GHS |
|
| Cas No. |
380151-85-9 |
| Chemical Name |
2-Formylphenylboronic Acid Pinacol Ester |
| UN No. |
- |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available