Potassium(4-Nitrophenyl)Trifluoroborate
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
Melting Point :
Boiling Point :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 5g |
2 -3 weeks |
95% |
|
|
|
| 10g |
2 -3 weeks |
95% |
|
|
|
| 25g |
2 -3 weeks |
95% |
|
|
|
| Transport Condition |
Room Temperature |
| Storage Temp. |
Inert atmosphere,Room Temperature |
| GHS Pictogram |
 |
| Hazard category |
- |
| Biological Activity |
|
| Character |
white (Powder) |
| Chemical Stability |
|
| Hazardous Decomposition Products |
|
| Useage |
|
| Risk Statements |
H315-H319-H335 |
| Flash Point |
|
| Safety Statements |
P261-P305+P351+P338 |
| Physicochemical Propertie |
|
| Vapor Pressure |
|
| Signal Word |
Warning |
| InchiKey |
VUFAMHLXAXZYSD-UHFFFAOYSA-N |
| Canonical Smiles |
[K+].[O-][N+](=O)C1C=CC(=CC=1)[B-](F)(F)F |
| Inchi |
InChI=1S/C6H4BF3NO2.K/c8-7(9,10)5-1-3-6(4-2-5)11(12)13;/h1-4H;/q-1;+1 |
| Density |
|
| MDL No. |
MFCD04115766 |
| Water Solubility |
|
| Exact Mass |
228.99243 |
| Chirality |
|
| GHS |
|
| Cas No. |
850623-71-1 |
| Chemical Name |
Potassium(4-Nitrophenyl)Trifluoroborate |
| UN No. |
- |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available