| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 5g | 2 -3 weeks | 97% | |||
| 25g | 2 -3 weeks | 97% |
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Inert atmosphere,Store in freezer, under -20°C |
| GHS Pictogram | ![]() |
| Hazard category | - |
| Biological Activity | |
| Character | white (Powder) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | SOZVPVAYKGJPJS-UHFFFAOYSA-N |
| Canonical Smiles | [K+].F[B-](F)(F)CCC1C=CC=CC=1 |
| Inchi | InChI=1S/C8H9BF3.K/c10-9(11,12)7-6-8-4-2-1-3-5-8;/h1-5H,6-7H2;/q-1;+1 |
| Density | |
| MDL No. | MFCD09039257 |
| Water Solubility | |
| Exact Mass | 212.03865 |
| Chirality | |
| GHS | |
| Cas No. | 329976-74-1 |
| Chemical Name | Potassium Phenethyltrifluoroborate |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory