| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 5g | 2 -3 weeks | 98% | |||
| 10g | 2 -3 weeks | 98% | |||
| 25g | 2 -3 weeks | 98% | |||
| 100g | 2 -3 weeks | 98% |
| Transport Condition | Room Temperature |
|---|---|
| Storage Temp. | Keep in dark place,Inert atmosphere,Room temperature |
| GHS Pictogram | ![]() |
| Hazard category | - |
| Biological Activity | |
| Character | colorless (Liquid) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H413 |
| Flash Point | |
| Safety Statements | P264-P270-P273-P301+P312-P330 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | QECMXXYJBBIFRJ-UHFFFAOYSA-N |
| Canonical Smiles | CSC1C=CC(=CC=1)B1OC(C)(C)C(C)(C)O1 |
| Inchi | InChI=1S/C13H19BO2S/c1-12(2)13(3,4)16-14(15-12)10-6-8-11(17-5)9-7-10/h6-9H,1-5H3 |
| Density | |
| MDL No. | MFCD05155222 |
| Water Solubility | |
| Exact Mass | 250.11988 |
| Chirality | |
| GHS | |
| Cas No. | 190788-58-0 |
| Chemical Name | 4,4,5,5-Tetramethyl-2-(4-Methylsulfanylphenyl)-[1,3,2]-Dioxaborolane |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory