| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 25g | 2 -3 weeks | 98% | |||
| 100g | 2 -3 weeks | 98% |
| Transport Condition | Store at room temperature |
|---|---|
| Storage Temp. | Store at room temperature |
| GHS Pictogram | ![]() |
| Hazard category | |
| Biological Activity | |
| Character | solid |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | JCDAUYWOHOLVMH-UHFFFAOYSA-N |
| Canonical Smiles | OB(O)C1=CC2=CC=CC=C2C2=CC=CC=C21 |
| Inchi | InChI=1S/C14H11BO2/c16-15(17)14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,16-17H |
| Density | 1.268 g/cm3 |
| MDL No. | MFCD00143524 |
| Water Solubility | sparingly soluble |
| Exact Mass | 222.08521 |
| Chirality | |
| GHS | |
| Cas No. | 68572-87-2 |
| Chemical Name | 9-Phenanthracenylboronic acid |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory