4-(2-Aminoethyl)cyclohexanol (cis- and trans- mixture)
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 250mg |
2 -3 weeks |
98% |
|
|
|
| 1g |
2 -3 weeks |
98% |
|
|
|
| 5g |
2 -3 weeks |
98% |
|
|
|
| Transport Condition |
Room temperature |
| Storage Temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| GHS Pictogram |
 |
| Hazard category |
8 |
| Character |
|
| Useage |
|
| Risk Statements |
H314 |
| Safety Statements |
P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| Physicochemical Propertie |
|
| Signal Word |
Danger |
| InchiKey |
FNHBFOVJIPXNFL-UHFFFAOYSA-N |
| Canonical Smiles |
NCCC1CCC(O)CC1 |
| Inchi |
InChI=1S/C8H17NO/c9-6-5-7-1-3-8(10)4-2-7/h7-8,10H,1-6,9H2 |
| MDL No. |
MFCD11520548 |
| GHS |
|
| Cas No. |
148356-06-3 |
| Chemical Name |
4-(2-Aminoethyl)cyclohexanol (cis- and trans- mixture) |
| UN No. |
2735 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available