Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 100mg | 2 -3 weeks | 95% | |
| 250mg | 2 -3 weeks | 95% | |
| 1g | 2 -3 weeks | 95% |
| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | - |
| Biological Activity | |
| Character | white(Solid) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | BPHJGVOFJPUMQE-UHFFFAOYSA-N |
| Canonical Smiles | Cl.NC1CCC(CC1)NC(=O)C1CCCC1 |
| Inchi | InChI=1S/C12H22N2O.ClH/c13-10-5-7-11(8-6-10)14-12(15)9-3-1-2-4-9;/h9-11H,1-8,13H2,(H,14,15);1H |
| Density | |
| MDL No. | MFCD23106604 |
| Water Solubility | |
| Exact Mass | 246.14989 |
| Chirality | |
| GHS | |
| Cas No. | 1286264-09-2 |
| Chemical Name | N-(trans-4-Aminocyclohexyl)cyclopentanecarboxamide hydrochloride |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
