| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Keep in dark place,Inert atmosphere,2-8°C |
| GHS Pictogram | ![]() |
| Hazard category | - |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H332-H335 |
| Flash Point | |
| Safety Statements | P261-P280-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | AJVXPGQYAKUTGX-UHFFFAOYSA-M |
| Canonical Smiles | CC1(C)C2=CC=CC(=C2OC2C(=CC=CC1=2)P(C1C=CC=CC=1)C1C=CC=CC=1)P(C1C=CC=CC=1)C1C=CC=CC=1.CS(=O)(=O)O[Pd]C1=CC=CC=C1C1=CC=CC=C1N |
| Inchi | InChI=1S/C39H32OP2.C12H10N.CH4O3S.Pd/c1-39(2)33-25-15-27-35(41(29-17-7-3-8-18-29)30-19-9-4-10-20-30)37(33)40-38-34(39)26-16-28-36(38)42(31-21-11-5-12-22-31)32-23-13-6-14-24-32;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5(2,3)4;/h3-28H,1-2H3;1-6,8-9H,13H2;1H3,(H,2,3,4);/q;;;+1/p-1 |
| Density | |
| MDL No. | MFCD22572675 |
| Water Solubility | |
| Exact Mass | 947.15793 |
| Chirality | |
| GHS | |
| Cas No. | 1445085-97-1 |
| Chemical Name | [2'-(Amino-κN)[1,1'-biphenyl]-2-yl-κC][[5-(diphenylphosphino)-9,9-dimethyl-9H-xanthen-4-yl]diphenylphosphine-κP](methanesulfonato-κO)palladium |
| UN No. | - |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory