| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 50mg | 2 -3 weeks | 98% | |||
| 100mg | 2 -3 weeks | 98% |
| Transport Condition | polypeptide, sealed storage, away from moisture and light |
|---|---|
| Storage Temp. | polypeptide, sealed storage, away from moisture and light |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | (Solid) |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | QCYMOOBOFFUBHZ-CPYYHODSSA-N |
| Canonical Smiles | C[C@H]1CN2[C@@H]([C@H]1O)C(=O)N[C@H](O)[C@H](O)C[C@H](N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H]([C@H](O)[C@@H](O)C1C=CC(O)=C(C=1)OS(O)(=O)=O)C(=O)N[C@@H]([C@H](O)CC(N)=O)C2=O |
| Inchi | InChI=1S/C35H52N8O20S/c1-11-9-43-25(26(11)50)33(57)41-31(55)19(48)7-15(36)29(53)38-22(12(2)44)34(58)42-10-14(45)6-16(42)30(54)40-24(32(56)39-23(35(43)59)18(47)8-21(37)49)28(52)27(51)13-3-4-17(46)20(5-13)63-64(60,61)62/h3-5,11-12,14-16,18-19,22-28,31,44-48,50-52,55H,6-10,36H2,1-2H3,(H2,37,49)(H,38,53)(H,39,56)(H,40,54)(H,41,57)(H,60,61,62)/t11-,12+,14+,15-,16-,18+,19+,22-,23-,24-,25-,26-,27-,28-,31+/m0/s1 |
| MDL No. | MFCD30478434 |
| GHS | |
| Cas No. | 168110-44-9 |
| Chemical Name | FR179642 |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory