| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | (Solid) |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | LYNRJPIDGDEFED-FVGYRXGTSA-N |
| Canonical Smiles | Cl.COC1C=CC2[C@@H](N)CCC=2C=1OC |
| Inchi | InChI=1S/C11H15NO2.ClH/c1-13-10-6-4-7-8(11(10)14-2)3-5-9(7)12;/h4,6,9H,3,5,12H2,1-2H3;1H/t9-;/m0./s1 |
| MDL No. | MFCD22393163 |
| GHS | |
| Cas No. | 168902-74-7 |
| Chemical Name | (S)-4,5-Dimethoxy-2,3-dihydro-1H-inden-1-amine hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory