Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 100mg | 2 -3 weeks | 98% | |||
| 250mg | 2 -3 weeks | 98% | |||
| 1g | 2 -3 weeks | 98% | |||
| 5g | 2 -3 weeks | 98% |
| Transport Condition | RT, sealed storage, away from moisture and light |
|---|---|
| Storage Temp. | RT, sealed storage, away from moisture and light |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | white(Solid) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | GQLJZDHBPFJQCF-OGFXRTJISA-N |
| Canonical Smiles | Cl.CC1C(=CC=CC=1C(F)(F)F)[C@@H](C)N |
| Inchi | InChI=1S/C10H12F3N.ClH/c1-6-8(7(2)14)4-3-5-9(6)10(11,12)13;/h3-5,7H,14H2,1-2H3;1H/t7-;/m1./s1 |
| Density | |
| MDL No. | MFCD24422178 |
| Water Solubility | |
| Exact Mass | 239.06886 |
| Chirality | |
| GHS | |
| Cas No. | 2230840-58-9 |
| Chemical Name | (R)-1-(2-Methyl-3-(trifluoromethyl)phenyl)ethan-1-amine hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
