rel-(1S,2S)-2-(trifluoromethyl)cyclobutan-1-amine hydrochloride
Catalog No. :
Cas No. :
Brand :
Molecular Formula :
Molecular Weight :
Melting Point :
Boiling Point :
| Pack Size |
Availability |
Purity |
Price |
User Price |
Quantity |
| 100mg |
2 -3 weeks |
97% |
|
|
|
| 250mg |
2 -3 weeks |
97% |
|
|
|
| Transport Condition |
Store at room temperature, keep dry and cool |
| Storage Temp. |
Store at room temperature, keep dry and cool |
| GHS Pictogram |
 |
| Hazard category |
|
| Biological Activity |
|
| Character |
white(Solid) |
| Chemical Stability |
|
| Hazardous Decomposition Products |
|
| Useage |
|
| Risk Statements |
H302-H315-H319-H335 |
| Flash Point |
|
| Safety Statements |
P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |
| Physicochemical Propertie |
|
| Vapor Pressure |
|
| Signal Word |
Warning |
| InchiKey |
YYYMJJAPNAKGEH-MMALYQPHSA-N |
| Canonical Smiles |
Cl.N[C@H]1CC[C@@H]1C(F)(F)F |
| Inchi |
InChI=1S/C5H8F3N.ClH/c6-5(7,8)3-1-2-4(3)9;/h3-4H,1-2,9H2;1H/t3-,4-;/m0./s1 |
| Density |
|
| MDL No. |
MFCD29049141 |
| Water Solubility |
|
| Exact Mass |
175.03756 |
| Chirality |
|
| GHS |
|
| Cas No. |
2307778-24-9 |
| Chemical Name |
rel-(1S,2S)-2-(trifluoromethyl)cyclobutan-1-amine hydrochloride |
| UN No. |
|
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available