Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 100mg | 2 -3 weeks | 98% | |||
| 250mg | 2 -3 weeks | 98% | |||
| 1g | 2 -3 weeks | 98% | |||
| 5g | 2 -3 weeks | 98% |
| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | white(Solid) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319 |
| Flash Point | |
| Safety Statements | P264-P280-P302+P352-P362+P364 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | MEPAINWSSZGNKL-UHFFFAOYSA-N |
| Canonical Smiles | Cl.CCC(N)C1C=CC(=CC=1)OC |
| Inchi | InChI=1S/C10H15NO.ClH/c1-3-10(11)8-4-6-9(12-2)7-5-8;/h4-7,10H,3,11H2,1-2H3;1H |
| Density | |
| MDL No. | MFCD06800956 |
| Water Solubility | |
| Exact Mass | 201.09204 |
| Chirality | |
| GHS | |
| Cas No. | 233608-13-4 |
| Chemical Name | 1-(4-Methoxyphenyl)propan-1-amine hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
