Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 1g | 2 -3 weeks | 95% | |||
| 5g | 2 -3 weeks | 95% | |||
| 25g | 2 -3 weeks | 95% | |||
| 100g | 2 -3 weeks | 95% |
| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | colorless(Viscous liquid) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302 |
| Flash Point | |
| Safety Statements | P264-P270-P330-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | JRPJBBBQIKFKEB-ZOWNYOTGSA-N |
| Canonical Smiles | Cl.COC(=O)[C@H](CCCCN)NC(=O)OCC1C=CC=CC=1 |
| Inchi | InChI=1S/C15H22N2O4.ClH/c1-20-14(18)13(9-5-6-10-16)17-15(19)21-11-12-7-3-2-4-8-12;/h2-4,7-8,13H,5-6,9-11,16H2,1H3,(H,17,19);1H/t13-;/m0./s1 |
| Density | |
| MDL No. | MFCD00077025 |
| Water Solubility | |
| Exact Mass | 330.13464 |
| Chirality | |
| GHS | |
| Cas No. | 26348-68-5 |
| Chemical Name | Z-Lys-OMe (hydrochloride) |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
