Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
|
Sorry, there is no price information yet |
|||||
| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |   |
| Hazard category | 8 |
| Biological Activity | |
| Character | off-white(Powder) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H318-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | DJHHDPHSCQTOJA-UHFFFAOYSA-N |
| Canonical Smiles | Br.NCCC1=CC2=CC=CC=C2C=C1 |
| Inchi | InChI=1S/C12H13N.BrH/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10;/h1-6,9H,7-8,13H2;1H |
| Density | |
| MDL No. | MFCD33022355 |
| Water Solubility | |
| Exact Mass | 251.03096 |
| Chirality | |
| GHS | |
| Cas No. | 2668984-44-7 |
| Chemical Name | 2-(Naphthalen-2-Yl)ethanamine hydrobromide |
| UN No. | 1759 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
