Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 5g | 2 -3 weeks | 97% | |||
| 10g | 2 -3 weeks | 97% | |||
| 25g | 2 -3 weeks | 97% |
| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | white(Solid) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P271-P280-P302+P352-P304+P340-P362+P364-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | WGWKNMLSVLOQJB-UHFFFAOYSA-N |
| Canonical Smiles | Br.CC(C)N |
| Inchi | InChI=1S/C3H9N.BrH/c1-3(2)4;/h3H,4H2,1-2H3;1H |
| Density | |
| MDL No. | MFCD22419143 |
| Water Solubility | |
| Exact Mass | 138.99966 |
| Chirality | |
| GHS | |
| Cas No. | 29552-58-7 |
| Chemical Name | Propan-2-amine hydrobromide |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
