| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram | ![]() |
| Hazard category | |
| Biological Activity | |
| Character | white(Powder) |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | XFCNYSGKNAWXFL-WCCKRBBISA-N |
| Canonical Smiles | Cl.CC(C)[C@H](N)C(N)=O |
| Inchi | InChI=1S/C5H12N2O.ClH/c1-3(2)4(6)5(7)8;/h3-4H,6H2,1-2H3,(H2,7,8);1H/t4-;/m0./s1 |
| Density | |
| MDL No. | MFCD00039085 |
| Water Solubility | |
| Exact Mass | 152.07164 |
| Chirality | |
| GHS | |
| Cas No. | 3014-80-0 |
| Chemical Name | L-Valinamide Hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory