| Transport Condition | RT, sealed storage, away from moisture and light |
|---|---|
| Storage Temp. | RT, sealed storage, away from moisture and light |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | white(Solid) |
| Useage | |
| Risk Statements | H302-H315-H319-H335 |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | FQGPPYPDTPEEGL-RGMNGODLSA-N |
| Canonical Smiles | C[C@H](N)C(=O)NC1C=CC(=CC=1)[N+]([O-])=O.OC(=O)C(F)(F)F |
| Inchi | InChI=1S/C9H11N3O3.C2HF3O2/c1-6(10)9(13)11-7-2-4-8(5-3-7)12(14)15;3-2(4,5)1(6)7/h2-6H,10H2,1H3,(H,11,13);(H,6,7)/t6-;/m0./s1 |
| MDL No. | 0 |
| GHS | |
| Cas No. | 82518-65-8 |
| Chemical Name | L-Alanine 4-nitroanilide (monotrifluoroacetate) |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory