| Transport Condition | 2-8℃ |
|---|---|
| Storage Temp. | 2-8℃ |
| GHS Pictogram | ![]() ![]() |
| Hazard category | 4.1 |
| Biological Activity | |
| Character | White to Off-White Powder or Crystals or Solid |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | chemical for research |
| Risk Statements | H228-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P210-P264-P271-P240-P261-P280-P305+P351+P338-P302+P352-P304+P340-P312-P362-P370+P378-P403+P233-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | warning |
|---|---|
| InchiKey | FKBFHOSFPRWJNV-UHFFFAOYSA-N |
| Canonical Smiles | CN(C)C(N(C)C)=[N+]1N=N(=O)C2=NC=CC=C12.[F-][P+5]([F-])([F-])([F-])([F-])[F-] |
| Inchi | InChI=1S/C10H15N6O.F6P/c1-13(2)10(14(3)4)15-8-6-5-7-11-9(8)16(17)12-15;1-7(2,3,4,5)6/h5-7H,1-4H3;/q+1;-1 |
| Density | |
| MDL No. | MFCD00274639 |
| Water Solubility | |
| Exact Mass | 380.09491 |
| Chirality | |
| GHS | |
| Cas No. | 148893-10-1 |
| Chemical Name | HATU |
| UN No. | 1325 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory