| Transport Condition | 2-8℃ |
|---|---|
| Storage Temp. | 2-8℃ |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | White To Red To Blue To Purple To Black Solid |
| Useage | |
| Risk Statements | H317 |
| Safety Statements | P261-P272-P280-P302+P352-P333+P313-P363-P403-P501 |
| Physicochemical Propertie |
| Signal Word | |
|---|---|
| InchiKey | UKSZBOKPHAQOMP-HIBFLRMTSA-N |
| Canonical Smiles | [Pd].O=C(/C=C/C1C=CC=CC=1)/C=C/C1C=CC=CC=1.O=C(/C=C/C1C=CC=CC=1)/C=C\C1C=CC=CC=1 |
| Inchi | InChI=1S/2C17H14O.Pd/c2*18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;/h2*1-14H;/b13-11+,14-12+;13-11-,14-12+; |
| MDL No. | MFCD00051942 |
| GHS | |
| Cas No. | 32005-36-0 |
| Chemical Name | Bis(dibenzylideneacetone)palladium(0) |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory