| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
| 5g | 2 -3 weeks | 98% | |||
| 25g | 2 -3 weeks | 98% | |||
| 100g | 2 -3 weeks | 98% |
| Transport Condition | 2-8°C, sealed storage, away from moisture and light |
|---|---|
| Storage Temp. | 2-8°C, sealed storage, away from moisture and light |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | white(Solid) |
| Useage | |
| Risk Statements | H315-H319 |
| Safety Statements | P264-P280-P337+P313-P305+P351+P338-P302+P352-P332+P313-P362 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | LAGICBLJBHDBSG-VVQWQMBKSA-N |
| Canonical Smiles | CC(C)(C)OC(=O)N[C@@H](CC1C=CC=CC=1)C[C@H](O)[C@@H](N)CC1C=CC=CC=1.CC(C)(C)OC(=O)N[C@@H](CC1C=CC=CC=1)C[C@H](O)[C@@H](N)CC1C=CC=CC=1.OC(=O)CCC(O)=O |
| Inchi | InChI=1S/2C23H32N2O3.C4H6O4/c2*1-23(2,3)28-22(27)25-19(14-17-10-6-4-7-11-17)16-21(26)20(24)15-18-12-8-5-9-13-18;5-3(6)1-2-4(7)8/h2*4-13,19-21,26H,14-16,24H2,1-3H3,(H,25,27);1-2H2,(H,5,6)(H,7,8)/t2*19-,20-,21-;/m00./s1 |
| MDL No. | MFCD11041076 |
| GHS | |
| Cas No. | 183388-64-9 |
| Chemical Name | Tert-butyl ((2S,4S,5S)-5-amino-4-hydroxy-1,6-diphenylhexan-2-yl)carbamate hemisuccinate |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Competitive Price
Delivery Speed
Technical Support
Stock Inventory