Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
|
Sorry, there is no price information yet |
|||
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Keep in dark place, Sealed in dry, 2-8°C |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H302 |
| Flash Point | |
| Safety Statements | P264, P270, P301+P317, P330, and P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | XCPNGUIESXJDEW-UHFFFAOYSA-N |
| Canonical Smiles | CN1N=C(N)C2C=C(F)C=CC1=2 |
| Inchi | InChI=1S/C8H8FN3/c1-12-7-3-2-5(9)4-6(7)8(10)11-12/h2-4H,1H3,(H2,10,11) |
| Density | |
| MDL No. | |
| Water Solubility | |
| Exact Mass | 165.07022 |
| Chirality | |
| GHS | |
| Cas No. | 171809-12-4 |
| Chemical Name | 5-Fluoro-1-methyl-1H-indazol-3-amine |
| UN No. | N/A |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
