Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 100 mg | In stock | 98%+ |
| Transport Condition | |
|---|---|
| Storage Temp. | 2-8°C, sealed storage, away from moisture and light |
| Hazard Codes |  |
| Hazard category | |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P330-P362+P364-P405-P501 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | COFVYBZUBPWZKR-UHFFFAOYSA-N |
| Canonical Smiles | CN1C=CC2=NC(Cl)=NC(N)=C12 |
| Inchi | InChI=1S/C7H7ClN4/c1-12-3-2-4-5(12)6(9)11-7(8)10-4/h2-3H,1H3,(H2,9,10,11) |
| Density | |
| MDL No. | MFCD21609252 |
| Water Solubility | |
| Exact Mass | 182.03592 |
| Chirality | |
| GHS | |
| Cas No. | 1375301-51-1 |
| Chemical Name | 2-Chloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
