| Transport Condition | Store at room temperature, keep dry and cool |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram | ![]() |
| Hazard category | |
| Character | light yellow(Solid) |
| Useage | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Risk Statements | H302-H315-H319-H335 |
| Safety Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362 |
| Physicochemical Propertie |
| Signal Word | Warning |
|---|---|
| InchiKey | HLXFQTDOPBFKOZ-UHFFFAOYSA-N |
| Canonical Smiles | Cl.CC1=CC(N)=CN2C=CN=C21 |
| Inchi | InChI=1S/C8H9N3.ClH/c1-6-4-7(9)5-11-3-2-10-8(6)11;/h2-5H,9H2,1H3;1H |
| MDL No. | MFCD28954404 |
| GHS | |
| Cas No. | 1803591-03-8 |
| Chemical Name | 8-Methylimidazo[1,2-a]pyridin-6-amine hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory