Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 100mg | In stock | 98% |
| Transport Condition | |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | HLXFQTDOPBFKOZ-UHFFFAOYSA-N |
| Canonical Smiles | Cl.CC1=CC(N)=CN2C=CN=C21 |
| Inchi | InChI=1S/C8H9N3.ClH/c1-6-4-7(9)5-11-3-2-10-8(6)11;/h2-5H,9H2,1H3;1H |
| Density | |
| MDL No. | MFCD28954404 |
| Water Solubility | |
| Exact Mass | 183.05632 |
| Chirality | |
| GHS | |
| Cas No. | 1803591-03-8 |
| Chemical Name | 8-Methylimidazo[1,2-a]pyridin-6-amine hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
