Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1g | In stock | 97% |
| Transport Condition | room temperature |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| GHS Pictogram |  |
| Hazard category | 8 |
| Biological Activity | |
| Character | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Risk Statements | H314 |
| Flash Point | |
| Safety Statements | P280-P305+P351+P338-P310 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | SELNOTDIMASHQX-UHFFFAOYSA-N |
| Canonical Smiles | Cl.Cl.CN1C=C(CN)C=N1 |
| Inchi | InChI=1S/C5H9N3.2ClH/c1-8-4-5(2-6)3-7-8;;/h3-4H,2,6H2,1H3;2*1H |
| Density | |
| MDL No. | MFCD09879170 |
| Water Solubility | |
| Exact Mass | 183.03300 |
| Chirality | |
| GHS | |
| Cas No. | 1185299-72-2 |
| Chemical Name | (1-Methyl-1H-pyrazol-4-yl)methanamine dihydrochloride |
| UN No. | 1759 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
