Popular keywords:
| Pack Size | Availability | Purity | Price | User Price | Quantity |
|---|---|---|---|---|---|
|
Sorry, there is no price information yet |
|||||
| Transport Condition | -20°C |
|---|---|
| Storage Temp. | -20°C, sealed storage, away from moisture |
| GHS Pictogram |   |
| Hazard category | |
| Biological Activity | |
| Character | soluble in alkaline solutions hardly soluble in water and acetone insoluble in ethanol and ether |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | P201-P202-P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P308+P313-P312-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Risk Statements | H315-H319-H335-H351 |
| Flash Point | |
| Safety Statements | |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | MGBDANYXBKROBW-UHFFFAOYSA-N |
| Canonical Smiles | CN1C(=O)C(N=O)=C(N)N(C)C1=O |
| Inchi | InChI=1S/C6H8N4O3/c1-9-4(7)3(8-13)5(11)10(2)6(9)12/h7H2,1-2H3 |
| Density | |
| MDL No. | MFCD00023799 |
| Water Solubility | |
| Exact Mass | 184.05964 |
| Chirality | |
| GHS | |
| Cas No. | 6632-68-4 |
| Chemical Name | 6-AMINO-1,3-DIMETHYL-5-NITROSOURACIL |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
Competitive Price
Delivery Speed
Technical Support
Stock Inventory
