Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 1 g | In stock | 97% |
| Transport Condition | room temperature |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| Hazard Codes |  |
| Hazard category | |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362-P403+P233-P501 |
| Dangerous Goods | |
| Risk Statements | H315-H319-H335 |
| Flash Point | |
| Safety Statements | |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | BYHOTUFEUBWUME-UHFFFAOYSA-N |
| Canonical Smiles | Cl.NCC1C=C2CCOC2=CC=1 |
| Inchi | InChI=1S/C9H11NO.ClH/c10-6-7-1-2-9-8(5-7)3-4-11-9;/h1-2,5H,3-4,6,10H2;1H |
| Density | |
| MDL No. | MFCD03659695 |
| Water Solubility | |
| Exact Mass | 185.06074 |
| Chirality | |
| GHS | |
| Cas No. | 635309-62-5 |
| Chemical Name | (2,3-Dihydrobenzofuran-5-yl)methanamine hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
