Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
|
Sorry, there is no price information yet |
|||
| Transport Condition | room temperature |
|---|---|
| Storage Temp. | Store at room temperature, keep dry and cool |
| Hazard Codes |  |
| Hazard category | |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | |
|---|---|
| InchiKey | FGZJADAEEWGMEC-BPNVWSNHSA-N |
| Canonical Smiles | Cl.CS(=O)(=O)[C@@H]1C[C@@H](N)C1 |
| Inchi | InChI=1S/C5H11NO2S.ClH/c1-9(7,8)5-2-4(6)3-5;/h4-5H,2-3,6H2,1H3;1H/t4-,5-; |
| Density | |
| MDL No. | MFCD22628711 |
| Water Solubility | |
| Exact Mass | 185.02773 |
| Chirality | |
| GHS | |
| Cas No. | 1408075-97-7 |
| Chemical Name | trans-3-(Methylsulfonyl)cyclobutanamine hydrochloride |
| UN No. |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
