Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
|
Sorry, there is no price information yet |
|||
| Transport Condition | 2-8°C |
|---|---|
| Storage Temp. | Sealed in dry, 2-8°C |
| GHS Pictogram |  |
| Hazard category | N/A |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | |
| Dangerous Goods | |
| Risk Statements | H302-H315-H319-H335 |
| Flash Point | |
| Safety Statements | P261-P305+P351+P338 |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Warning |
|---|---|
| InchiKey | BJDCWCLMFKKGEE-HVDUHBCDSA-N |
| Canonical Smiles | C[C@@]12CC[C@H]3[C@H](C)CC[C@H]4[C@@H](C)C(O)O[C@H](O1)[C@]43OO2 |
| Inchi | InChI=1S/C15H24O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-13,16H,4-7H2,1-3H3/t8-,9-,10+,11+,12?,13-,14-,15-/m1/s1 |
| Density | |
| MDL No. | MFCD28384156 |
| Water Solubility | |
| Exact Mass | 284.16238 |
| Chirality | |
| GHS | |
| Cas No. | 131175-87-6 |
| Chemical Name | Dihydroartemisinin (mixture of α and β isomers) |
| UN No. | N/A |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
