Hello, Welcome to Chemicalbridge
| Pack Size | Availability | Purity | Price |
|---|---|---|---|
| 100mg | 2 -3 weeks | 95%+,mixture of isomers | |
| 250mg | 2 -3 weeks | 95%+,mixture of isomers | |
| 1g | 2 -3 weeks | 95%+,mixture of isomers | |
| 5g | 2 -3 weeks | 95%+,mixture of isomers | |
| 25g | 2 -3 weeks | 95%+,mixture of isomers |
| Transport Condition | under -20°C |
|---|---|
| Storage Temp. | Keep in dark place, inert atmosphere, store in freezer, under -20°C |
| GHS Pictogram |   |
| Hazard category | 6.1 |
| Biological Activity | |
| Chemical Stability | |
| Hazardous Decomposition Products | |
| Useage | P501-P261-P272-P270-P271-P264-P280-P284-P302+P352-P342+P311-P337+P313-P305+P351+P338-P362+P364-P333+P313-P301+P312+P330-P304+P340+P312-P403+P233-P405 |
| Dangerous Goods | |
| Risk Statements | H302+H332-H315-H319-H317-H334-H335 |
| Flash Point | |
| Safety Statements | |
| Physicochemical Propertie | |
| Vapor Pressure |
| Signal Word | Danger |
|---|---|
| InchiKey | AEWCEHLYVLRLBF-UHFFFAOYSA-N |
| Canonical Smiles | OC1=CC2OC3C=C(O)C=CC=3C3(OC(=O)C4C=CC(=CC3=4)N=C=S)C=2C=C1.OC1=CC2OC3C=C(O)C=CC=3C3(OC(=O)C4C=C(C=CC3=4)N=C=S)C=2C=C1 |
| Inchi | InChI=1S/2C21H11NO5S/c23-12-2-5-16-18(8-12)26-19-9-13(24)3-6-17(19)21(16)15-4-1-11(22-10-28)7-14(15)20(25)27-21;23-12-2-5-15-18(8-12)26-19-9-13(24)3-6-16(19)21(15)17-7-11(22-10-28)1-4-14(17)20(25)27-21/h2*1-9,23-24H |
| Density | |
| MDL No. | MFCD22575282 |
| Water Solubility | |
| Exact Mass | 778.07159 |
| Chirality | |
| GHS | |
| Cas No. | 27072-45-3 |
| Chemical Name | Fluorescein Isothiocyanate |
| UN No. | 2811 |
Sorry, there are currently no product details available
Sorry, there is currently no relevant literature available
Sorry, there is currently no browsing history
